C14H18FNO2 — CID 114710240
7-fluoro-2-(5-methyloxolan-2-yl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 114710240) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 7-fluoro-2-(5-methyloxolan-2-yl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | 7-fluoro-2-(5-methyloxolan-2-yl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 114710240 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 7-fluoro-2-(5-methyloxolan-2-yl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CC1CCC(C2CC(N)c3ccc(F)cc3O2)O1 |
| InChI | InChI=1S/C14H18FNO2/c1-8-2-5-12(17-8)14-7-11(16)10-4-3-9(15)6-13(10)18-14/h3-4,6,8,11-12,14H,2,5,7,16H2,1H3 |
| InChIKey | XZOHPYUVPYGRJZ-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |