C16H22FNO — CID 104947810
(4R)-7-fluoro-2-(3-methylcyclohexyl)-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104947810) has the molecular formula C16H22FNO and a molecular weight of 263.36 g/mol. Its IUPAC name is (4R)-7-fluoro-2-(3-methylcyclohexyl)-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-7-fluoro-2-(3-methylcyclohexyl)-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104947810 |
| Molecular Formula | C16H22FNO |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (4R)-7-fluoro-2-(3-methylcyclohexyl)-3,4-dihydro-2H-chromen-4-amine |
| SMILES | CC1CCCC(C2C[C@@H](N)c3ccc(F)cc3O2)C1 |
| InChI | InChI=1S/C16H22FNO/c1-10-3-2-4-11(7-10)15-9-14(18)13-6-5-12(17)8-16(13)19-15/h5-6,8,10-11,14-15H,2-4,7,9,18H2,1H3/t10?,11?,14-,15?/m1/s1 |
| InChIKey | NYHPDBZIFUPHBO-ULKLSYCYSA-N |
| XLogP | 3.80 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |