C15H12Cl2FNO — CID 104947901
(4R)-2-(2,3-dichlorophenyl)-7-fluoro-3,4-dihydro-2H-chromen-4-amine (PubChem CID 104947901) has the molecular formula C15H12Cl2FNO and a molecular weight of 312.17 g/mol. Its IUPAC name is (4R)-2-(2,3-dichlorophenyl)-7-fluoro-3,4-dihydro-2H-chromen-4-amine.
| Compound Name | (4R)-2-(2,3-dichlorophenyl)-7-fluoro-3,4-dihydro-2H-chromen-4-amine |
|---|---|
| PubChem CID | 104947901 |
| Molecular Formula | C15H12Cl2FNO |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 311.03 |
| IUPAC Name | (4R)-2-(2,3-dichlorophenyl)-7-fluoro-3,4-dihydro-2H-chromen-4-amine |
| SMILES | N[C@@H]1CC(c2cccc(Cl)c2Cl)Oc2cc(F)ccc21 |
| InChI | InChI=1S/C15H12Cl2FNO/c16-11-3-1-2-10(15(11)17)14-7-12(19)9-5-4-8(18)6-13(9)20-14/h1-6,12,14H,7,19H2/t12-,14?/m1/s1 |
| InChIKey | IFHBYQATFIQEDI-PUODRLBUSA-N |
| XLogP | 4.66 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |