C14H19ClO2 — CID 104949258
(4R)-6-chloro-2-pentan-2-yl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104949258) has the molecular formula C14H19ClO2 and a molecular weight of 254.76 g/mol. Its IUPAC name is (4R)-6-chloro-2-pentan-2-yl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4R)-6-chloro-2-pentan-2-yl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104949258 |
| Molecular Formula | C14H19ClO2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | (4R)-6-chloro-2-pentan-2-yl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CCCC(C)C1C[C@@H](O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C14H19ClO2/c1-3-4-9(2)14-8-12(16)11-7-10(15)5-6-13(11)17-14/h5-7,9,12,14,16H,3-4,8H2,1-2H3/t9?,12-,14?/m1/s1 |
| InChIKey | SEQBGIOJWJEDOS-VTGPFMDVSA-N |
| XLogP | 3.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |