C12H15ClO2 — CID 114714596
6-chloro-2-propan-2-yl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 114714596) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is 6-chloro-2-propan-2-yl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | 6-chloro-2-propan-2-yl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 114714596 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 6-chloro-2-propan-2-yl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | CC(C)C1CC(O)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C12H15ClO2/c1-7(2)12-6-10(14)9-5-8(13)3-4-11(9)15-12/h3-5,7,10,12,14H,6H2,1-2H3 |
| InChIKey | BEGLDQQKEKGXCL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |