C11H14O4S — CID 118028314
3-ethyl-6-methylsulfonyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 118028314) has the molecular formula C11H14O4S and a molecular weight of 242.30 g/mol. Its IUPAC name is 3-ethyl-6-methylsulfonyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 3-ethyl-6-methylsulfonyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 118028314 |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 3-ethyl-6-methylsulfonyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCC1COc2ccc(S(C)(=O)=O)cc2O1 |
| InChI | InChI=1S/C11H14O4S/c1-3-8-7-14-10-5-4-9(16(2,12)13)6-11(10)15-8/h4-6,8H,3,7H2,1-2H3 |
| InChIKey | QIZABQSUSXAMFS-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |