C15H17BrO2 — CID 104951328
(4R)-6-bromo-2-cyclohex-3-en-1-yl-3,4-dihydro-2H-chromen-4-ol (PubChem CID 104951328) has the molecular formula C15H17BrO2 and a molecular weight of 309.20 g/mol. Its IUPAC name is (4R)-6-bromo-2-cyclohex-3-en-1-yl-3,4-dihydro-2H-chromen-4-ol.
| Compound Name | (4R)-6-bromo-2-cyclohex-3-en-1-yl-3,4-dihydro-2H-chromen-4-ol |
|---|---|
| PubChem CID | 104951328 |
| Molecular Formula | C15H17BrO2 |
| Molecular Weight | 309.20 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | (4R)-6-bromo-2-cyclohex-3-en-1-yl-3,4-dihydro-2H-chromen-4-ol |
| SMILES | O[C@@H]1CC(C2CC=CCC2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H17BrO2/c16-11-6-7-14-12(8-11)13(17)9-15(18-14)10-4-2-1-3-5-10/h1-2,6-8,10,13,15,17H,3-5,9H2/t10?,13-,15?/m1/s1 |
| InChIKey | CEWLKXDBBJFHAN-VROQLPPWSA-N |
| XLogP | 3.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.20 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|