C10H11NO3 — CID 67628394
N,2-dimethyl-1,3-benzodioxole-5-carboxamide (PubChem CID 67628394) has the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. Its IUPAC name is N,2-dimethyl-1,3-benzodioxole-5-carboxamide.
| Compound Name | N,2-dimethyl-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 67628394 |
| Molecular Formula | C10H11NO3 |
| Molecular Weight | 193.20 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | N,2-dimethyl-1,3-benzodioxole-5-carboxamide |
| SMILES | CNC(=O)c1ccc2c(c1)OC(C)O2 |
| InChI | InChI=1S/C10H11NO3/c1-6-13-8-4-3-7(10(12)11-2)5-9(8)14-6/h3-6H,1-2H3,(H,11,12) |
| InChIKey | ORXLKNWZIQMBCN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |