C16H17BrN2O2S — CID 58424801
CID 58424801 (PubChem CID 58424801) has the molecular formula C16H17BrN2O2S and a molecular weight of 381.30 g/mol.
| Compound Name | CID 58424801 |
|---|---|
| PubChem CID | 58424801 |
| Molecular Formula | C16H17BrN2O2S |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | — |
| SMILES | O=C1NC(=S)NC12CC1(CCCCC1)Oc1ccc(Br)cc12 |
| InChI | InChI=1S/C16H17BrN2O2S/c17-10-4-5-12-11(8-10)16(13(20)18-14(22)19-16)9-15(21-12)6-2-1-3-7-15/h4-5,8H,1-3,6-7,9H2,(H2,18,19,20,22) |
| InChIKey | DPFKBJFIEQKYRW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|