C18H14BrClN2OS — CID 143944279
6-bromo-2-(3-chlorophenyl)-2'-sulfanylidenespiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-4'-one (PubChem CID 143944279) has the molecular formula C18H14BrClN2OS and a molecular weight of 421.75 g/mol. Its IUPAC name is 6-bromo-2-(3-chlorophenyl)-2'-sulfanylidenespiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-4'-one.
| Compound Name | 6-bromo-2-(3-chlorophenyl)-2'-sulfanylidenespiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-4'-one |
|---|---|
| PubChem CID | 143944279 |
| Molecular Formula | C18H14BrClN2OS |
| Molecular Weight | 421.75 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 6-bromo-2-(3-chlorophenyl)-2'-sulfanylidenespiro[2,3-dihydro-1H-naphthalene-4,5'-imidazolidine]-4'-one |
| SMILES | O=C1NC(=S)NC12CC(c1cccc(Cl)c1)Cc1ccc(Br)cc12 |
| InChI | InChI=1S/C18H14BrClN2OS/c19-13-5-4-11-6-12(10-2-1-3-14(20)7-10)9-18(15(11)8-13)16(23)21-17(24)22-18/h1-5,7-8,12H,6,9H2,(H2,21,22,23,24) |
| InChIKey | IBMKAPCVZWZEBS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.75 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|