C18H14BrClO — CID 46242278
(5S)-3-(4-bromophenyl)-5-(3-chlorophenyl)cyclohex-2-en-1-one (PubChem CID 46242278) has the molecular formula C18H14BrClO and a molecular weight of 361.67 g/mol. Its IUPAC name is (5S)-3-(4-bromophenyl)-5-(3-chlorophenyl)cyclohex-2-en-1-one.
| Compound Name | (5S)-3-(4-bromophenyl)-5-(3-chlorophenyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 46242278 |
| Molecular Formula | C18H14BrClO |
| Molecular Weight | 361.67 g/mol |
| Exact Mass | 359.99 |
| IUPAC Name | (5S)-3-(4-bromophenyl)-5-(3-chlorophenyl)cyclohex-2-en-1-one |
| SMILES | O=C1C=C(c2ccc(Br)cc2)C[C@H](c2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C18H14BrClO/c19-16-6-4-12(5-7-16)14-8-15(11-18(21)10-14)13-2-1-3-17(20)9-13/h1-7,9-10,15H,8,11H2/t15-/m0/s1 |
| InChIKey | SOKIALIZEPRRHK-HNNXBMFYSA-N |
| XLogP | 5.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |