C18H20ClNO2 — CID 135403551
5-(3-chlorophenyl)-2-(cyclopentyliminomethyl)-3-hydroxycyclohex-2-en-1-one (PubChem CID 135403551) has the molecular formula C18H20ClNO2 and a molecular weight of 317.82 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2-(cyclopentyliminomethyl)-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 5-(3-chlorophenyl)-2-(cyclopentyliminomethyl)-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135403551 |
| Molecular Formula | C18H20ClNO2 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.12 |
| IUPAC Name | 5-(3-chlorophenyl)-2-(cyclopentyliminomethyl)-3-hydroxycyclohex-2-en-1-one |
| SMILES | O=C1CC(c2cccc(Cl)c2)CC(O)=C1/C=N/C1CCCC1 |
| InChI | InChI=1S/C18H20ClNO2/c19-14-5-3-4-12(8-14)13-9-17(21)16(18(22)10-13)11-20-15-6-1-2-7-15/h3-5,8,11,13,15,21H,1-2,6-7,9-10H2/b20-11+ |
| InChIKey | JHAIUTSIZSRYRE-RGVLZGJSSA-N |
| XLogP | 4.61 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|