C18H14Cl2O2S — CID 118708924
5-(3-chlorophenyl)-2-(2-chlorophenyl)sulfanyl-3-hydroxycyclohex-2-en-1-one (PubChem CID 118708924) has the molecular formula C18H14Cl2O2S and a molecular weight of 365.28 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-2-(2-chlorophenyl)sulfanyl-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 5-(3-chlorophenyl)-2-(2-chlorophenyl)sulfanyl-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 118708924 |
| Molecular Formula | C18H14Cl2O2S |
| Molecular Weight | 365.28 g/mol |
| Exact Mass | 364.01 |
| IUPAC Name | 5-(3-chlorophenyl)-2-(2-chlorophenyl)sulfanyl-3-hydroxycyclohex-2-en-1-one |
| SMILES | O=C1CC(c2cccc(Cl)c2)CC(O)=C1Sc1ccccc1Cl |
| InChI | InChI=1S/C18H14Cl2O2S/c19-13-5-3-4-11(8-13)12-9-15(21)18(16(22)10-12)23-17-7-2-1-6-14(17)20/h1-8,12,21H,9-10H2 |
| InChIKey | USTRLPGVEOTAJW-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.28 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |