C19H18O4S2 — CID 118708885
3-hydroxy-2-(2-methylsulfonylphenyl)sulfanyl-5-phenylcyclohex-2-en-1-one (PubChem CID 118708885) has the molecular formula C19H18O4S2 and a molecular weight of 374.48 g/mol. Its IUPAC name is 3-hydroxy-2-(2-methylsulfonylphenyl)sulfanyl-5-phenylcyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-2-(2-methylsulfonylphenyl)sulfanyl-5-phenylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 118708885 |
| Molecular Formula | C19H18O4S2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 3-hydroxy-2-(2-methylsulfonylphenyl)sulfanyl-5-phenylcyclohex-2-en-1-one |
| SMILES | CS(=O)(=O)c1ccccc1SC1=C(O)CC(c2ccccc2)CC1=O |
| InChI | InChI=1S/C19H18O4S2/c1-25(22,23)18-10-6-5-9-17(18)24-19-15(20)11-14(12-16(19)21)13-7-3-2-4-8-13/h2-10,14,20H,11-12H2,1H3 |
| InChIKey | CHLFTWQQOQUQIW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |