C20H20O2S — CID 118708949
3-hydroxy-2-[(3-methylphenyl)methylsulfanyl]-5-phenylcyclohex-2-en-1-one (PubChem CID 118708949) has the molecular formula C20H20O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 3-hydroxy-2-[(3-methylphenyl)methylsulfanyl]-5-phenylcyclohex-2-en-1-one.
| Compound Name | 3-hydroxy-2-[(3-methylphenyl)methylsulfanyl]-5-phenylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 118708949 |
| Molecular Formula | C20H20O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 3-hydroxy-2-[(3-methylphenyl)methylsulfanyl]-5-phenylcyclohex-2-en-1-one |
| SMILES | Cc1cccc(CSC2=C(O)CC(c3ccccc3)CC2=O)c1 |
| InChI | InChI=1S/C20H20O2S/c1-14-6-5-7-15(10-14)13-23-20-18(21)11-17(12-19(20)22)16-8-3-2-4-9-16/h2-10,17,21H,11-13H2,1H3 |
| InChIKey | BKLDIFDYQXPHMD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |