C15H15ClINO2 — CID 163672909
5-(3-chlorophenyl)-3-hydroxy-2-(2-iodoethyliminomethyl)cyclohex-2-en-1-one (PubChem CID 163672909) has the molecular formula C15H15ClINO2 and a molecular weight of 403.65 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3-hydroxy-2-(2-iodoethyliminomethyl)cyclohex-2-en-1-one.
| Compound Name | 5-(3-chlorophenyl)-3-hydroxy-2-(2-iodoethyliminomethyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 163672909 |
| Molecular Formula | C15H15ClINO2 |
| Molecular Weight | 403.65 g/mol |
| Exact Mass | 402.98 |
| IUPAC Name | 5-(3-chlorophenyl)-3-hydroxy-2-(2-iodoethyliminomethyl)cyclohex-2-en-1-one |
| SMILES | O=C1CC(c2cccc(Cl)c2)CC(O)=C1/C=N/CCI |
| InChI | InChI=1S/C15H15ClINO2/c16-12-3-1-2-10(6-12)11-7-14(19)13(15(20)8-11)9-18-5-4-17/h1-3,6,9,11,19H,4-5,7-8H2/b18-9+ |
| InChIKey | RSXKBLUGOMPYMH-GIJQJNRQSA-N |
| XLogP | 4.10 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|