C19H21ClN2O2 — CID 136800590
2-[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-5-(3-chlorophenyl)-3-hydroxycyclohex-2-en-1-one (PubChem CID 136800590) has the molecular formula C19H21ClN2O2 and a molecular weight of 344.84 g/mol. Its IUPAC name is 2-[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-5-(3-chlorophenyl)-3-hydroxycyclohex-2-en-1-one.
| Compound Name | 2-[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-5-(3-chlorophenyl)-3-hydroxycyclohex-2-en-1-one |
|---|---|
| PubChem CID | 136800590 |
| Molecular Formula | C19H21ClN2O2 |
| Molecular Weight | 344.84 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 2-[(3aS,7aS)-3a,4,5,6,7,7a-hexahydro-1H-benzimidazol-2-yl]-5-(3-chlorophenyl)-3-hydroxycyclohex-2-en-1-one |
| SMILES | O=C1CC(c2cccc(Cl)c2)CC(O)=C1C1=N[C@H]2CCCC[C@@H]2N1 |
| InChI | InChI=1S/C19H21ClN2O2/c20-13-5-3-4-11(8-13)12-9-16(23)18(17(24)10-12)19-21-14-6-1-2-7-15(14)22-19/h3-5,8,12,14-15,23H,1-2,6-7,9-10H2,(H,21,22)/t12?,14-,15-/m0/s1 |
| InChIKey | MIOVYEWMXIXEFR-ZRNAQANOSA-N |
| XLogP | 3.91 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |