C13H11ClN2O — CID 41386742
(6R)-6-(3-chlorophenyl)-1,5,6,7-tetrahydroindazol-4-one (PubChem CID 41386742) has the molecular formula C13H11ClN2O and a molecular weight of 246.70 g/mol. Its IUPAC name is (6R)-6-(3-chlorophenyl)-1,5,6,7-tetrahydroindazol-4-one.
| Compound Name | (6R)-6-(3-chlorophenyl)-1,5,6,7-tetrahydroindazol-4-one |
|---|---|
| PubChem CID | 41386742 |
| Molecular Formula | C13H11ClN2O |
| Molecular Weight | 246.70 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (6R)-6-(3-chlorophenyl)-1,5,6,7-tetrahydroindazol-4-one |
| SMILES | O=C1C[C@H](c2cccc(Cl)c2)Cc2[nH]ncc21 |
| InChI | InChI=1S/C13H11ClN2O/c14-10-3-1-2-8(4-10)9-5-12-11(7-15-16-12)13(17)6-9/h1-4,7,9H,5-6H2,(H,15,16)/t9-/m1/s1 |
| InChIKey | VPYIKCALJPSVPO-SECBINFHSA-N |
| XLogP | 2.98 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.70 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |