C12H11ClN2 — CID 78012737
4-(3-chlorophenyl)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole (PubChem CID 78012737) has the molecular formula C12H11ClN2 and a molecular weight of 218.69 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole.
| Compound Name | 4-(3-chlorophenyl)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole |
|---|---|
| PubChem CID | 78012737 |
| Molecular Formula | C12H11ClN2 |
| Molecular Weight | 218.69 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | 4-(3-chlorophenyl)-1,4,5,6-tetrahydrocyclopenta[d]pyrazole |
| SMILES | Clc1cccc(C2CCc3[nH]ncc32)c1 |
| InChI | InChI=1S/C12H11ClN2/c13-9-3-1-2-8(6-9)10-4-5-12-11(10)7-14-15-12/h1-3,6-7,10H,4-5H2,(H,14,15) |
| InChIKey | WPLWEFNKFMYKKC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.69 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |