C19H17ClO2 — CID 42628199
(5R)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)cyclohex-2-en-1-one (PubChem CID 42628199) has the molecular formula C19H17ClO2 and a molecular weight of 312.80 g/mol. Its IUPAC name is (5R)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)cyclohex-2-en-1-one.
| Compound Name | (5R)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 42628199 |
| Molecular Formula | C19H17ClO2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (5R)-3-(3-chlorophenyl)-5-(4-methoxyphenyl)cyclohex-2-en-1-one |
| SMILES | COc1ccc([C@H]2CC(=O)C=C(c3cccc(Cl)c3)C2)cc1 |
| InChI | InChI=1S/C19H17ClO2/c1-22-19-7-5-13(6-8-19)15-9-16(12-18(21)11-15)14-3-2-4-17(20)10-14/h2-8,10,12,15H,9,11H2,1H3/t15-/m1/s1 |
| InChIKey | CBBAIMCCRTXBRQ-OAHLLOKOSA-N |
| XLogP | 4.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |