C20H20O4 — CID 13129301
3-(2-hydroxy-4,6-dimethoxyphenyl)-5-phenylcyclohex-2-en-1-one (PubChem CID 13129301) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 3-(2-hydroxy-4,6-dimethoxyphenyl)-5-phenylcyclohex-2-en-1-one.
| Compound Name | 3-(2-hydroxy-4,6-dimethoxyphenyl)-5-phenylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 13129301 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 3-(2-hydroxy-4,6-dimethoxyphenyl)-5-phenylcyclohex-2-en-1-one |
| SMILES | COc1cc(O)c(C2=CC(=O)CC(c3ccccc3)C2)c(OC)c1 |
| InChI | InChI=1S/C20H20O4/c1-23-17-11-18(22)20(19(12-17)24-2)15-8-14(9-16(21)10-15)13-6-4-3-5-7-13/h3-7,10-12,14,22H,8-9H2,1-2H3 |
| InChIKey | WEBXWHPPNNCMKR-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |