C34H38Br2N4O5S — CID 158592820
CID 158592820 (PubChem CID 158592820) has the molecular formula C34H38Br2N4O5S and a molecular weight of 774.58 g/mol.
| Compound Name | CID 158592820 |
|---|---|
| PubChem CID | 158592820 |
| Molecular Formula | C34H38Br2N4O5S |
| Molecular Weight | 774.58 g/mol |
| Exact Mass | 772.09 |
| IUPAC Name | — |
| SMILES | CC1CCC2(CC1)CC1(NC(=O)NC1=O)c1cc(Br)ccc1O2.CC1CCC2(CC1)CC1(NC(=S)NC1=O)c1cc(Br)ccc1O2 |
| InChI | InChI=1S/C17H19BrN2O3.C17H19BrN2O2S/c1-10-4-6-16(7-5-10)9-17(14(21)19-15(22)20-17)12-8-11(18)2-3-13(12)23-16;1-10-4-6-16(7-5-10)9-17(14(21)19-15(23)20-17)12-8-11(18)2-3-13(12)22-16/h2-3,8,10H,4-7,9H2,1H3,(H2,19,20,21,22);2-3,8,10H,4-7,9H2,1H3,(H2,19,20,21,23) |
| InChIKey | HUQPJHJHGHDXDL-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.58 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|