C25H27Br2N3O6 — CID 161148384
6-bromo-2,2-dimethyl-3H-chromen-4-one;6-bromo-2,2-dimethylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione;formamide (PubChem CID 161148384) has the molecular formula C25H27Br2N3O6 and a molecular weight of 625.31 g/mol. Its IUPAC name is 6-bromo-2,2-dimethyl-3H-chromen-4-one;6-bromo-2,2-dimethylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione;formamide.
| Compound Name | 6-bromo-2,2-dimethyl-3H-chromen-4-one;6-bromo-2,2-dimethylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione;formamide |
|---|---|
| PubChem CID | 161148384 |
| Molecular Formula | C25H27Br2N3O6 |
| Molecular Weight | 625.31 g/mol |
| Exact Mass | 623.03 |
| IUPAC Name | 6-bromo-2,2-dimethyl-3H-chromen-4-one;6-bromo-2,2-dimethylspiro[3H-chromene-4,5'-imidazolidine]-2',4'-dione;formamide |
| SMILES | CC1(C)CC(=O)c2cc(Br)ccc2O1.CC1(C)CC2(NC(=O)NC2=O)c2cc(Br)ccc2O1.NC=O |
| InChI | InChI=1S/C13H13BrN2O3.C11H11BrO2.CH3NO/c1-12(2)6-13(10(17)15-11(18)16-13)8-5-7(14)3-4-9(8)19-12;1-11(2)6-9(13)8-5-7(12)3-4-10(8)14-11;2-1-3/h3-5H,6H2,1-2H3,(H2,15,16,17,18);3-5H,6H2,1-2H3;1H,(H2,2,3) |
| InChIKey | UOIXGOTWACRARD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.31 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|