About 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane]
6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane] (PubChem CID 22568885) has the molecular formula C13H15BrO
and a molecular weight of 267.17 g/mol. Its IUPAC name is 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane].
Molecular Properties
| Compound Name | 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane] |
| PubChem CID | 22568885 |
| Molecular Formula | C13H15BrO |
| Molecular Weight | 267.17 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane] |
| SMILES | CC1(C)CC2(CC2)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C13H15BrO/c1-12(2)8-13(5-6-13)15-11-4-3-9(14)7-10(11)12/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | FJWHLTBVUDQGRV-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.17 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane]?
The IUPAC name of 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane] (CID 22568885) is 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane].
What is the SMILES notation for 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane]?
The canonical SMILES for 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane] is CC1(C)CC2(CC2)Oc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane]?
The InChIKey is FJWHLTBVUDQGRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15BrO/c1-12(2)8-13(5-6-13)15-11-4-3-9(14)7-10(11)12/h3-4,7H,5-6,8H2,1-2H3.
What are the key properties of 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane]?
6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane] has a molecular weight of 267.17 g/mol, XLogP of 4.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,4-dimethylspiro[3H-chromene-2,1'-cyclopropane] is sourced from PubChem (CID 22568885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).