About 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane]
7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane] (PubChem CID 164899375) has the molecular formula C14H17BrO
and a molecular weight of 281.19 g/mol. Its IUPAC name is 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane].
Molecular Properties
| Compound Name | 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane] |
| PubChem CID | 164899375 |
| Molecular Formula | C14H17BrO |
| Molecular Weight | 281.19 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane] |
| SMILES | Brc1ccc2c(c1)OC1(CCCCC1)CC2 |
| InChI | InChI=1S/C14H17BrO/c15-12-5-4-11-6-9-14(16-13(11)10-12)7-2-1-3-8-14/h4-5,10H,1-3,6-9H2 |
| InChIKey | RXLAIHZQSQXAKS-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.19 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane]?
The IUPAC name of 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane] (CID 164899375) is 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane].
What is the SMILES notation for 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane]?
The canonical SMILES for 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane] is Brc1ccc2c(c1)OC1(CCCCC1)CC2.
What is the InChIKey of 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane]?
The InChIKey is RXLAIHZQSQXAKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrO/c15-12-5-4-11-6-9-14(16-13(11)10-12)7-2-1-3-8-14/h4-5,10H,1-3,6-9H2.
What are the key properties of 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane]?
7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane] has a molecular weight of 281.19 g/mol, XLogP of 4.48, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromospiro[3,4-dihydrochromene-2,1'-cyclohexane] is sourced from PubChem (CID 164899375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).