C16H20BrN3O3 — CID 91212084
CID 91212084 (PubChem CID 91212084) has the molecular formula C16H20BrN3O3 and a molecular weight of 382.26 g/mol.
| Compound Name | CID 91212084 |
|---|---|
| PubChem CID | 91212084 |
| Molecular Formula | C16H20BrN3O3 |
| Molecular Weight | 382.26 g/mol |
| Exact Mass | 381.07 |
| IUPAC Name | — |
| SMILES | CN1C(N)=NC2(CC3(CCOCC3)Oc3ccc(Br)cc32)C1O |
| InChI | InChI=1S/C16H20BrN3O3/c1-20-13(21)16(19-14(20)18)9-15(4-6-22-7-5-15)23-12-3-2-10(17)8-11(12)16/h2-3,8,13,21H,4-7,9H2,1H3,(H2,18,19) |
| InChIKey | BLGZSQPOXIVVRC-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.26 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |