About CID 91574227
CID 91574227 (PubChem CID 91574227) has the molecular formula C23H23ClN4O3
and a molecular weight of 438.92 g/mol.
Molecular Properties
| Compound Name | CID 91574227 |
| PubChem CID | 91574227 |
| Molecular Formula | C23H23ClN4O3 |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.15 |
| IUPAC Name | — |
| SMILES | CN1C(N)=NC2(CC3(CCCOC3)Oc3ccc(-c4cc(Cl)cc(C#N)c4)cc32)C1O |
| InChI | InChI=1S/C23H23ClN4O3/c1-28-20(29)23(27-21(28)26)12-22(5-2-6-30-13-22)31-19-4-3-15(10-18(19)23)16-7-14(11-25)8-17(24)9-16/h3-4,7-10,20,29H,2,5-6,12-13H2,1H3,(H2,26,27) |
| InChIKey | FJRUERFANSVLMZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 91574227 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91574227?
The IUPAC name of CID 91574227 (CID 91574227) is not available.
What is the SMILES notation for CID 91574227?
The canonical SMILES for CID 91574227 is CN1C(N)=NC2(CC3(CCCOC3)Oc3ccc(-c4cc(Cl)cc(C#N)c4)cc32)C1O.
What is the InChIKey of CID 91574227?
The InChIKey is FJRUERFANSVLMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23ClN4O3/c1-28-20(29)23(27-21(28)26)12-22(5-2-6-30-13-22)31-19-4-3-15(10-18(19)23)16-7-14(11-25)8-17(24)9-16/h3-4,7-10,20,29H,2,5-6,12-13H2,1H3,(H2,26,27).
What are the key properties of CID 91574227?
CID 91574227 has a molecular weight of 438.92 g/mol, XLogP of 2.98, 1 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91574227 is sourced from PubChem (CID 91574227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).