About CID 71077829
CID 71077829 (PubChem CID 71077829) has the molecular formula C23H21F2N3O3
and a molecular weight of 425.44 g/mol.
Molecular Properties
| Compound Name | CID 71077829 |
| PubChem CID | 71077829 |
| Molecular Formula | C23H21F2N3O3 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | — |
| SMILES | N#Cc1cccc(-c2ccc3c(c2)[C@@]2(C[C@@]4(CCCOC4)O3)OC(N)=NCC2(F)F)c1 |
| InChI | InChI=1S/C23H21F2N3O3/c24-23(25)13-28-20(27)31-22(23)12-21(7-2-8-29-14-21)30-19-6-5-17(10-18(19)22)16-4-1-3-15(9-16)11-26/h1,3-6,9-10H,2,7-8,12-14H2,(H2,27,28)/t21-,22-/m1/s1 |
| InChIKey | QYNGYWDOJKPIJX-FGZHOGPDSA-N |
| XLogP | 3.73 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 71077829 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 71077829?
The IUPAC name of CID 71077829 (CID 71077829) is not available.
What is the SMILES notation for CID 71077829?
The canonical SMILES for CID 71077829 is N#Cc1cccc(-c2ccc3c(c2)[C@@]2(C[C@@]4(CCCOC4)O3)OC(N)=NCC2(F)F)c1.
What is the InChIKey of CID 71077829?
The InChIKey is QYNGYWDOJKPIJX-FGZHOGPDSA-N. The full InChI is InChI=1S/C23H21F2N3O3/c24-23(25)13-28-20(27)31-22(23)12-21(7-2-8-29-14-21)30-19-6-5-17(10-18(19)22)16-4-1-3-15(9-16)11-26/h1,3-6,9-10H,2,7-8,12-14H2,(H2,27,28)/t21-,22-/m1/s1.
What are the key properties of CID 71077829?
CID 71077829 has a molecular weight of 425.44 g/mol, XLogP of 3.73, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 71077829 is sourced from PubChem (CID 71077829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).