C17H14BrN3O2S — CID 87177926
4-amino-2-(3-bromophenyl)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-imidazole-5-thione (PubChem CID 87177926) has the molecular formula C17H14BrN3O2S and a molecular weight of 404.29 g/mol. Its IUPAC name is 4-amino-2-(3-bromophenyl)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-imidazole-5-thione.
| Compound Name | 4-amino-2-(3-bromophenyl)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-imidazole-5-thione |
|---|---|
| PubChem CID | 87177926 |
| Molecular Formula | C17H14BrN3O2S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 4-amino-2-(3-bromophenyl)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1H-imidazole-5-thione |
| SMILES | NC1=NC(c2cccc(Br)c2)(c2ccc3c(c2)OCCO3)NC1=S |
| InChI | InChI=1S/C17H14BrN3O2S/c18-12-3-1-2-10(8-12)17(20-15(19)16(24)21-17)11-4-5-13-14(9-11)23-7-6-22-13/h1-5,8-9H,6-7H2,(H2,19,20)(H,21,24) |
| InChIKey | BIUMDDMMPKOXTP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|