About 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene
6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene (PubChem CID 57107782) has the molecular formula C15H21BrOS2
and a molecular weight of 361.37 g/mol. Its IUPAC name is 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene.
Molecular Properties
| Compound Name | 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene |
| PubChem CID | 57107782 |
| Molecular Formula | C15H21BrOS2 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene |
| SMILES | CCCSC1(SCCC)CCOc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H21BrOS2/c1-3-9-18-15(19-10-4-2)7-8-17-14-6-5-12(16)11-13(14)15/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | XYGWPMLEWLCFLI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene?
The IUPAC name of 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene (CID 57107782) is 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene.
What is the SMILES notation for 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene?
The canonical SMILES for 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene is CCCSC1(SCCC)CCOc2ccc(Br)cc21.
What is the InChIKey of 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene?
The InChIKey is XYGWPMLEWLCFLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21BrOS2/c1-3-9-18-15(19-10-4-2)7-8-17-14-6-5-12(16)11-13(14)15/h5-6,11H,3-4,7-10H2,1-2H3.
What are the key properties of 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene?
6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene has a molecular weight of 361.37 g/mol, XLogP of 5.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene is sourced from PubChem (CID 57107782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).