C15H21BrOS2 — CID 57107782
6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene (PubChem CID 57107782) has the molecular formula C15H21BrOS2 and a molecular weight of 361.37 g/mol. Its IUPAC name is 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene.
| Compound Name | 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene |
|---|---|
| PubChem CID | 57107782 |
| Molecular Formula | C15H21BrOS2 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 6-bromo-4,4-bis(propylsulfanyl)-2,3-dihydrochromene |
| SMILES | CCCSC1(SCCC)CCOc2ccc(Br)cc21 |
| InChI | InChI=1S/C15H21BrOS2/c1-3-9-18-15(19-10-4-2)7-8-17-14-6-5-12(16)11-13(14)15/h5-6,11H,3-4,7-10H2,1-2H3 |
| InChIKey | XYGWPMLEWLCFLI-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|