C21H30BrNO2S — CID 131741307
N-(6-bromo-1-ethenyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-yl)-2-methylpropane-2-sulfinamide (PubChem CID 131741307) has the molecular formula C21H30BrNO2S and a molecular weight of 440.45 g/mol. Its IUPAC name is N-(6-bromo-1-ethenyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-yl)-2-methylpropane-2-sulfinamide.
| Compound Name | N-(6-bromo-1-ethenyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-yl)-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 131741307 |
| Molecular Formula | C21H30BrNO2S |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 439.12 |
| IUPAC Name | N-(6-bromo-1-ethenyl-4'-methoxyspiro[3H-indene-2,1'-cyclohexane]-1-yl)-2-methylpropane-2-sulfinamide |
| SMILES | C=CC1(NS(=O)C(C)(C)C)c2cc(Br)ccc2CC12CCC(OC)CC2 |
| InChI | InChI=1S/C21H30BrNO2S/c1-6-21(23-26(24)19(2,3)4)18-13-16(22)8-7-15(18)14-20(21)11-9-17(25-5)10-12-20/h6-8,13,17,23H,1,9-12,14H2,2-5H3 |
| InChIKey | YPQGVQZRXMMQBN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|