About N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide
N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide (PubChem CID 178039158) has the molecular formula C14H20BrNO2S
and a molecular weight of 346.29 g/mol. Its IUPAC name is N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide |
| PubChem CID | 178039158 |
| Molecular Formula | C14H20BrNO2S |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide |
| SMILES | CC1(NS(=O)C(C)(C)C)CCOc2cc(Br)ccc21 |
| InChI | InChI=1S/C14H20BrNO2S/c1-13(2,3)19(17)16-14(4)7-8-18-12-9-10(15)5-6-11(12)14/h5-6,9,16H,7-8H2,1-4H3 |
| InChIKey | CABPRGGTKCENOU-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide?
The IUPAC name of N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide (CID 178039158) is N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide.
What is the SMILES notation for N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide?
The canonical SMILES for N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide is CC1(NS(=O)C(C)(C)C)CCOc2cc(Br)ccc21.
What is the InChIKey of N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide?
The InChIKey is CABPRGGTKCENOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20BrNO2S/c1-13(2,3)19(17)16-14(4)7-8-18-12-9-10(15)5-6-11(12)14/h5-6,9,16H,7-8H2,1-4H3.
What are the key properties of N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide?
N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide has a molecular weight of 346.29 g/mol, XLogP of 3.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(7-bromo-4-methyl-2,3-dihydrochromen-4-yl)-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 178039158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).