C13H17BrClNO2S — CID 130407805
N-[3-(4-bromo-2-chlorophenyl)oxetan-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 130407805) has the molecular formula C13H17BrClNO2S and a molecular weight of 366.71 g/mol. Its IUPAC name is N-[3-(4-bromo-2-chlorophenyl)oxetan-3-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[3-(4-bromo-2-chlorophenyl)oxetan-3-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 130407805 |
| Molecular Formula | C13H17BrClNO2S |
| Molecular Weight | 366.71 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | N-[3-(4-bromo-2-chlorophenyl)oxetan-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC(C)(C)S(=O)NC1(c2ccc(Br)cc2Cl)COC1 |
| InChI | InChI=1S/C13H17BrClNO2S/c1-12(2,3)19(17)16-13(7-18-8-13)10-5-4-9(14)6-11(10)15/h4-6,16H,7-8H2,1-3H3 |
| InChIKey | IXCQGPIAKXHYDR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.71 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |