C12H14BrNO3 — CID 118957466
ethyl 7-bromo-4-hydroxy-2,3-dihydrochromene-4-carboximidate (PubChem CID 118957466) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is ethyl 7-bromo-4-hydroxy-2,3-dihydrochromene-4-carboximidate.
| Compound Name | ethyl 7-bromo-4-hydroxy-2,3-dihydrochromene-4-carboximidate |
|---|---|
| PubChem CID | 118957466 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | ethyl 7-bromo-4-hydroxy-2,3-dihydrochromene-4-carboximidate |
| SMILES | [H]/N=C(\OCC)C1(O)CCOc2cc(Br)ccc21 |
| InChI | InChI=1S/C12H14BrNO3/c1-2-16-11(14)12(15)5-6-17-10-7-8(13)3-4-9(10)12/h3-4,7,14-15H,2,5-6H2,1H3/b14-11- |
| InChIKey | XVUKDROLTWYLMS-KAMYIIQDSA-N |
| XLogP | 2.43 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|