C12H14BrNO2 — CID 125481759
ethyl (1S)-5-bromo-1-hydroxy-2,3-dihydroindene-1-carboximidate (PubChem CID 125481759) has the molecular formula C12H14BrNO2 and a molecular weight of 284.15 g/mol. Its IUPAC name is ethyl (1S)-5-bromo-1-hydroxy-2,3-dihydroindene-1-carboximidate.
| Compound Name | ethyl (1S)-5-bromo-1-hydroxy-2,3-dihydroindene-1-carboximidate |
|---|---|
| PubChem CID | 125481759 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | ethyl (1S)-5-bromo-1-hydroxy-2,3-dihydroindene-1-carboximidate |
| SMILES | [H]/N=C(\OCC)[C@]1(O)CCc2cc(Br)ccc21 |
| InChI | InChI=1S/C12H14BrNO2/c1-2-16-11(14)12(15)6-5-8-7-9(13)3-4-10(8)12/h3-4,7,14-15H,2,5-6H2,1H3/b14-11-/t12-/m0/s1 |
| InChIKey | SVSPVTNOFOXECG-PBBNAPBQSA-N |
| XLogP | 2.60 |
| TPSA | 53.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|