C18H13ClN3O5+ — CID 10596275
3-(3-chlorophenyl)-4-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]-2H-oxadiazol-3-ium-5-one (PubChem CID 10596275) has the molecular formula C18H13ClN3O5+ and a molecular weight of 386.77 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-4-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]-2H-oxadiazol-3-ium-5-one.
| Compound Name | 3-(3-chlorophenyl)-4-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 10596275 |
| Molecular Formula | C18H13ClN3O5+ |
| Molecular Weight | 386.77 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 3-(3-chlorophenyl)-4-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]-2H-oxadiazol-3-ium-5-one |
| SMILES | O=C(CC1(O)C(=O)Nc2ccccc21)c1c(=O)o[nH][n+]1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H12ClN3O5/c19-10-4-3-5-11(8-10)22-15(16(24)27-21-22)14(23)9-18(26)12-6-1-2-7-13(12)20-17(18)25/h1-8,26H,9H2,(H-,20,21,23,24,25)/p+1 |
| InChIKey | DCQTYVVFDQKCFG-UHFFFAOYSA-O |
| XLogP | 1.31 |
| TPSA | 116.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.77 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|