C19H16N3O6+ — CID 10714840
4-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]-3-(2-methoxyphenyl)-2H-oxadiazol-3-ium-5-one (PubChem CID 10714840) has the molecular formula C19H16N3O6+ and a molecular weight of 382.35 g/mol. Its IUPAC name is 4-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]-3-(2-methoxyphenyl)-2H-oxadiazol-3-ium-5-one.
| Compound Name | 4-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]-3-(2-methoxyphenyl)-2H-oxadiazol-3-ium-5-one |
|---|---|
| PubChem CID | 10714840 |
| Molecular Formula | C19H16N3O6+ |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-[2-(3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]-3-(2-methoxyphenyl)-2H-oxadiazol-3-ium-5-one |
| SMILES | COc1ccccc1-[n+]1[nH]oc(=O)c1C(=O)CC1(O)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C19H15N3O6/c1-27-15-9-5-4-8-13(15)22-16(17(24)28-21-22)14(23)10-19(26)11-6-2-3-7-12(11)20-18(19)25/h2-9,26H,10H2,1H3,(H-,20,21,23,24,25)/p+1 |
| InChIKey | RWLTZMYFOGLRQJ-UHFFFAOYSA-O |
| XLogP | 0.67 |
| TPSA | 125.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|