C12H13NO4 — CID 14903574
methyl 3-(3-hydroxy-2-oxo-1H-indol-3-yl)propanoate (PubChem CID 14903574) has the molecular formula C12H13NO4 and a molecular weight of 235.24 g/mol. Its IUPAC name is methyl 3-(3-hydroxy-2-oxo-1H-indol-3-yl)propanoate.
| Compound Name | methyl 3-(3-hydroxy-2-oxo-1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 14903574 |
| Molecular Formula | C12H13NO4 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | methyl 3-(3-hydroxy-2-oxo-1H-indol-3-yl)propanoate |
| SMILES | COC(=O)CCC1(O)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C12H13NO4/c1-17-10(14)6-7-12(16)8-4-2-3-5-9(8)13-11(12)15/h2-5,16H,6-7H2,1H3,(H,13,15) |
| InChIKey | AGJNZWMUJBSBIH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |