C20H22Cl2N2O — CID 141199660
6-chloro-3-[(3-chlorophenyl)methyl]-3-(pentan-3-ylamino)-1H-indol-2-one (PubChem CID 141199660) has the molecular formula C20H22Cl2N2O and a molecular weight of 377.32 g/mol. Its IUPAC name is 6-chloro-3-[(3-chlorophenyl)methyl]-3-(pentan-3-ylamino)-1H-indol-2-one.
| Compound Name | 6-chloro-3-[(3-chlorophenyl)methyl]-3-(pentan-3-ylamino)-1H-indol-2-one |
|---|---|
| PubChem CID | 141199660 |
| Molecular Formula | C20H22Cl2N2O |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 6-chloro-3-[(3-chlorophenyl)methyl]-3-(pentan-3-ylamino)-1H-indol-2-one |
| SMILES | CCC(CC)NC1(Cc2cccc(Cl)c2)C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H22Cl2N2O/c1-3-16(4-2)24-20(12-13-6-5-7-14(21)10-13)17-9-8-15(22)11-18(17)23-19(20)25/h5-11,16,24H,3-4,12H2,1-2H3,(H,23,25) |
| InChIKey | ARTFGKDQXIMCLW-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |