C21H25Cl2N3O — CID 68566776
3-[2-aminoethyl(butan-2-yl)amino]-6-chloro-3-[(3-chlorophenyl)methyl]-1H-indol-2-one (PubChem CID 68566776) has the molecular formula C21H25Cl2N3O and a molecular weight of 406.36 g/mol. Its IUPAC name is 3-[2-aminoethyl(butan-2-yl)amino]-6-chloro-3-[(3-chlorophenyl)methyl]-1H-indol-2-one.
| Compound Name | 3-[2-aminoethyl(butan-2-yl)amino]-6-chloro-3-[(3-chlorophenyl)methyl]-1H-indol-2-one |
|---|---|
| PubChem CID | 68566776 |
| Molecular Formula | C21H25Cl2N3O |
| Molecular Weight | 406.36 g/mol |
| Exact Mass | 405.14 |
| IUPAC Name | 3-[2-aminoethyl(butan-2-yl)amino]-6-chloro-3-[(3-chlorophenyl)methyl]-1H-indol-2-one |
| SMILES | CCC(C)N(CCN)C1(Cc2cccc(Cl)c2)C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H25Cl2N3O/c1-3-14(2)26(10-9-24)21(13-15-5-4-6-16(22)11-15)18-8-7-17(23)12-19(18)25-20(21)27/h4-8,11-12,14H,3,9-10,13,24H2,1-2H3,(H,25,27) |
| InChIKey | AGFOXDVYLJMHTM-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.36 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |