C22H15Cl2F3N2O2 — CID 24950440
6-chloro-3-[(3-chlorophenyl)methyl]-3-[3-(trifluoromethoxy)anilino]-1H-indol-2-one (PubChem CID 24950440) has the molecular formula C22H15Cl2F3N2O2 and a molecular weight of 467.27 g/mol. Its IUPAC name is 6-chloro-3-[(3-chlorophenyl)methyl]-3-[3-(trifluoromethoxy)anilino]-1H-indol-2-one.
| Compound Name | 6-chloro-3-[(3-chlorophenyl)methyl]-3-[3-(trifluoromethoxy)anilino]-1H-indol-2-one |
|---|---|
| PubChem CID | 24950440 |
| Molecular Formula | C22H15Cl2F3N2O2 |
| Molecular Weight | 467.27 g/mol |
| Exact Mass | 466.05 |
| IUPAC Name | 6-chloro-3-[(3-chlorophenyl)methyl]-3-[3-(trifluoromethoxy)anilino]-1H-indol-2-one |
| SMILES | O=C1Nc2cc(Cl)ccc2C1(Cc1cccc(Cl)c1)Nc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C22H15Cl2F3N2O2/c23-14-4-1-3-13(9-14)12-21(18-8-7-15(24)10-19(18)28-20(21)30)29-16-5-2-6-17(11-16)31-22(25,26)27/h1-11,29H,12H2,(H,28,30) |
| InChIKey | ICGGMXMBZJRAJE-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.27 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |