C20H20Cl2N2O — CID 24950916
6-chloro-3-[(3-chlorophenyl)methyl]-3-(2-methylpyrrolidin-1-yl)-1H-indol-2-one (PubChem CID 24950916) has the molecular formula C20H20Cl2N2O and a molecular weight of 375.30 g/mol. Its IUPAC name is 6-chloro-3-[(3-chlorophenyl)methyl]-3-(2-methylpyrrolidin-1-yl)-1H-indol-2-one.
| Compound Name | 6-chloro-3-[(3-chlorophenyl)methyl]-3-(2-methylpyrrolidin-1-yl)-1H-indol-2-one |
|---|---|
| PubChem CID | 24950916 |
| Molecular Formula | C20H20Cl2N2O |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 6-chloro-3-[(3-chlorophenyl)methyl]-3-(2-methylpyrrolidin-1-yl)-1H-indol-2-one |
| SMILES | CC1CCCN1C1(Cc2cccc(Cl)c2)C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C20H20Cl2N2O/c1-13-4-3-9-24(13)20(12-14-5-2-6-15(21)10-14)17-8-7-16(22)11-18(17)23-19(20)25/h2,5-8,10-11,13H,3-4,9,12H2,1H3,(H,23,25) |
| InChIKey | LXDVGMXWQGUQKA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |