C26H32Cl2N2O2 — CID 143373595
6-chloro-3-[(3-chlorophenyl)methyl]-3-cyclohexyl-1H-indol-2-one;N-propan-2-ylacetamide (PubChem CID 143373595) has the molecular formula C26H32Cl2N2O2 and a molecular weight of 475.46 g/mol. Its IUPAC name is 6-chloro-3-[(3-chlorophenyl)methyl]-3-cyclohexyl-1H-indol-2-one;N-propan-2-ylacetamide.
| Compound Name | 6-chloro-3-[(3-chlorophenyl)methyl]-3-cyclohexyl-1H-indol-2-one;N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 143373595 |
| Molecular Formula | C26H32Cl2N2O2 |
| Molecular Weight | 475.46 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 6-chloro-3-[(3-chlorophenyl)methyl]-3-cyclohexyl-1H-indol-2-one;N-propan-2-ylacetamide |
| SMILES | CC(=O)NC(C)C.O=C1Nc2cc(Cl)ccc2C1(Cc1cccc(Cl)c1)C1CCCCC1 |
| InChI | InChI=1S/C21H21Cl2NO.C5H11NO/c22-16-8-4-5-14(11-16)13-21(15-6-2-1-3-7-15)18-10-9-17(23)12-19(18)24-20(21)25;1-4(2)6-5(3)7/h4-5,8-12,15H,1-3,6-7,13H2,(H,24,25);4H,1-3H3,(H,6,7) |
| InChIKey | OCRLZULLXOJBGY-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.46 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |