C26H23Cl3N4O2 — CID 11998894
3-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]-N-(6-chloro-3-pyridinyl)piperidine-1-carboxamide (PubChem CID 11998894) has the molecular formula C26H23Cl3N4O2 and a molecular weight of 529.86 g/mol. Its IUPAC name is 3-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]-N-(6-chloro-3-pyridinyl)piperidine-1-carboxamide.
| Compound Name | 3-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]-N-(6-chloro-3-pyridinyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 11998894 |
| Molecular Formula | C26H23Cl3N4O2 |
| Molecular Weight | 529.86 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | 3-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]-N-(6-chloro-3-pyridinyl)piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)nc1)N1CCCC(C2(Cc3cccc(Cl)c3)C(=O)Nc3cc(Cl)ccc32)C1 |
| InChI | InChI=1S/C26H23Cl3N4O2/c27-18-5-1-3-16(11-18)13-26(21-8-6-19(28)12-22(21)32-24(26)34)17-4-2-10-33(15-17)25(35)31-20-7-9-23(29)30-14-20/h1,3,5-9,11-12,14,17H,2,4,10,13,15H2,(H,31,35)(H,32,34) |
| InChIKey | WWINKBBIUAUKLF-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.86 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|