C24H16Cl2N2O3 — CID 141199707
1-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]indole-2-carboxylic acid (PubChem CID 141199707) has the molecular formula C24H16Cl2N2O3 and a molecular weight of 451.31 g/mol. Its IUPAC name is 1-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]indole-2-carboxylic acid.
| Compound Name | 1-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]indole-2-carboxylic acid |
|---|---|
| PubChem CID | 141199707 |
| Molecular Formula | C24H16Cl2N2O3 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | 1-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2ccccc2n1C1(Cc2cccc(Cl)c2)C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C24H16Cl2N2O3/c25-16-6-3-4-14(10-16)13-24(18-9-8-17(26)12-19(18)27-23(24)31)28-20-7-2-1-5-15(20)11-21(28)22(29)30/h1-12H,13H2,(H,27,31)(H,29,30) |
| InChIKey | DEGYGDDSWAEQKJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |