C21H25Cl2N3O3S — CID 68562696
N-[2-[2-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]propan-2-ylamino]ethyl]methanesulfonamide (PubChem CID 68562696) has the molecular formula C21H25Cl2N3O3S and a molecular weight of 470.42 g/mol. Its IUPAC name is N-[2-[2-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]propan-2-ylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[2-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]propan-2-ylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 68562696 |
| Molecular Formula | C21H25Cl2N3O3S |
| Molecular Weight | 470.42 g/mol |
| Exact Mass | 469.10 |
| IUPAC Name | N-[2-[2-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]propan-2-ylamino]ethyl]methanesulfonamide |
| SMILES | CC(C)(NCCNS(C)(=O)=O)C1(Cc2cccc(Cl)c2)C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H25Cl2N3O3S/c1-20(2,24-9-10-25-30(3,28)29)21(13-14-5-4-6-15(22)11-14)17-8-7-16(23)12-18(17)26-19(21)27/h4-8,11-12,24-25H,9-10,13H2,1-3H3,(H,26,27) |
| InChIKey | FFOXULUJESDZIB-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|