C23H25Cl2NO3 — CID 70320059
4-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]octanoic acid (PubChem CID 70320059) has the molecular formula C23H25Cl2NO3 and a molecular weight of 434.36 g/mol. Its IUPAC name is 4-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]octanoic acid.
| Compound Name | 4-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]octanoic acid |
|---|---|
| PubChem CID | 70320059 |
| Molecular Formula | C23H25Cl2NO3 |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | 4-[6-chloro-3-[(3-chlorophenyl)methyl]-2-oxo-1H-indol-3-yl]octanoic acid |
| SMILES | CCCCC(CCC(=O)O)C1(Cc2cccc(Cl)c2)C(=O)Nc2cc(Cl)ccc21 |
| InChI | InChI=1S/C23H25Cl2NO3/c1-2-3-6-16(8-11-21(27)28)23(14-15-5-4-7-17(24)12-15)19-10-9-18(25)13-20(19)26-22(23)29/h4-5,7,9-10,12-13,16H,2-3,6,8,11,14H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | GKRYDEUBRVMRBT-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |