C21H19ClF2N2O2S — CID 143538652
(2'S,3R)-6-chloro-2'-(2,3-difluoro-6-propan-2-yloxyphenyl)-6'-sulfanylidenespiro[1H-indole-3,3'-piperidine]-2-one (PubChem CID 143538652) has the molecular formula C21H19ClF2N2O2S and a molecular weight of 436.91 g/mol. Its IUPAC name is (2'S,3R)-6-chloro-2'-(2,3-difluoro-6-propan-2-yloxyphenyl)-6'-sulfanylidenespiro[1H-indole-3,3'-piperidine]-2-one.
| Compound Name | (2'S,3R)-6-chloro-2'-(2,3-difluoro-6-propan-2-yloxyphenyl)-6'-sulfanylidenespiro[1H-indole-3,3'-piperidine]-2-one |
|---|---|
| PubChem CID | 143538652 |
| Molecular Formula | C21H19ClF2N2O2S |
| Molecular Weight | 436.91 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (2'S,3R)-6-chloro-2'-(2,3-difluoro-6-propan-2-yloxyphenyl)-6'-sulfanylidenespiro[1H-indole-3,3'-piperidine]-2-one |
| SMILES | CC(C)Oc1ccc(F)c(F)c1[C@H]1NC(=S)CC[C@]12C(=O)Nc1cc(Cl)ccc12 |
| InChI | InChI=1S/C21H19ClF2N2O2S/c1-10(2)28-15-6-5-13(23)18(24)17(15)19-21(8-7-16(29)26-19)12-4-3-11(22)9-14(12)25-20(21)27/h3-6,9-10,19H,7-8H2,1-2H3,(H,25,27)(H,26,29)/t19-,21-/m1/s1 |
| InChIKey | QCHOAIPPARTCJD-TZIWHRDSSA-N |
| XLogP | 5.05 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.91 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|