C32H24BrCl3N2O5 — CID 66656473
methyl 4-[4-bromo-2-[(2'R,3R,4'S)-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]phenoxy]-3-chlorobenzoate (PubChem CID 66656473) has the molecular formula C32H24BrCl3N2O5 and a molecular weight of 702.82 g/mol. Its IUPAC name is methyl 4-[4-bromo-2-[(2'R,3R,4'S)-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]phenoxy]-3-chlorobenzoate.
| Compound Name | methyl 4-[4-bromo-2-[(2'R,3R,4'S)-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]phenoxy]-3-chlorobenzoate |
|---|---|
| PubChem CID | 66656473 |
| Molecular Formula | C32H24BrCl3N2O5 |
| Molecular Weight | 702.82 g/mol |
| Exact Mass | 699.99 |
| IUPAC Name | methyl 4-[4-bromo-2-[(2'R,3R,4'S)-6-chloro-4'-(5-chlorocyclohexa-2,4-dien-1-yl)-2,6'-dioxospiro[1H-indole-3,3'-piperidine]-2'-yl]phenoxy]-3-chlorobenzoate |
| SMILES | COC(=O)c1ccc(Oc2ccc(Br)cc2[C@H]2NC(=O)C[C@@H](C3C=CC=C(Cl)C3)[C@]23C(=O)Nc2cc(Cl)ccc23)c(Cl)c1 |
| InChI | InChI=1S/C32H24BrCl3N2O5/c1-42-30(40)17-5-9-27(24(36)12-17)43-26-10-6-18(33)13-21(26)29-32(22-8-7-20(35)14-25(22)37-31(32)41)23(15-28(39)38-29)16-3-2-4-19(34)11-16/h2-10,12-14,16,23,29H,11,15H2,1H3,(H,37,41)(H,38,39)/t16?,23-,29+,32-/m0/s1 |
| InChIKey | BGFMBINGKLMALY-XIMIUTJTSA-N |
| XLogP | 8.10 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.82 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |