C26H17BrCl3F3N2O3 — CID 76568133
4'-[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]-6-chloro-6'-(2,5-dichlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione (PubChem CID 76568133) has the molecular formula C26H17BrCl3F3N2O3 and a molecular weight of 648.69 g/mol. Its IUPAC name is 4'-[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]-6-chloro-6'-(2,5-dichlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione.
| Compound Name | 4'-[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]-6-chloro-6'-(2,5-dichlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
|---|---|
| PubChem CID | 76568133 |
| Molecular Formula | C26H17BrCl3F3N2O3 |
| Molecular Weight | 648.69 g/mol |
| Exact Mass | 645.94 |
| IUPAC Name | 4'-[5-bromo-2-(2,2,2-trifluoroethoxy)phenyl]-6-chloro-6'-(2,5-dichlorophenyl)spiro[1H-indole-3,5'-piperidine]-2,2'-dione |
| SMILES | O=C1CC(c2cc(Br)ccc2OCC(F)(F)F)C2(C(=O)Nc3cc(Cl)ccc32)C(c2cc(Cl)ccc2Cl)N1 |
| InChI | InChI=1S/C26H17BrCl3F3N2O3/c27-12-1-6-21(38-11-25(31,32)33)15(7-12)18-10-22(36)35-23(16-8-13(28)3-5-19(16)30)26(18)17-4-2-14(29)9-20(17)34-24(26)37/h1-9,18,23H,10-11H2,(H,34,37)(H,35,36) |
| InChIKey | SWMRWPIWKAFBFP-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.69 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |